Appendix C — Review of Matrices and the Singular Value Decomposition

For more info after class on fundamental matrix properties, see the Matrix Cookbook

%matplotlib inline
import numpy as np
import matplotlib
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import Axes3D
from ipywidgets import interact
import seaborn as sns
sns.set(style="darkgrid")
sns.set_palette("Set1", 8, .75)
sns.set_color_codes()

# Below are just to tell NumPy to print things nicely
np.set_printoptions(precision=3)
np.set_printoptions(suppress=True)
np.set_printoptions(threshold=5)

Let’s generate a simple circle of points, so that we can see what Matrices do to objects:

def circle_points(a=1,b=1):
    ''' Generates points on a ellipsoid on axes length a,b'''
    t = np.linspace(0,2*np.pi,25)   # Define a line
    X = np.matrix([a*np.cos(t),b*np.sin(t)]) # Create circle using polar coords
    return X

def plot_circle(X,title=None):
    fig = plt.figure()
    ax = fig.add_subplot(111)
    ax.scatter(X[0].flat, X[1].flat,c='g')
    if(title):
        plt.title(title)
    plt.axis('equal')
    plt.show()
X = circle_points()
print('X:', X.shape)
print(X)
plot_circle(X,'A Unit Circle')
X: (2, 25)
[[ 1.     0.966  0.866 ...  0.866  0.966  1.   ]
 [ 0.     0.259  0.5   ... -0.5   -0.259 -0.   ]]

M = np.matrix([[2, 0],[0, 1]])
print('M'); print(M)
M
[[2 0]
 [0 1]]
def plot_transformed_circle(X,NewX, title=None):
    fig = plt.figure()
    ax = fig.add_subplot(111)
    plt.scatter(X[0].flat, X[1].flat, c='g')
    plt.scatter(NewX[0].flat, NewX[1].flat, c='b')
    plt.plot(X[0].flat, X[1].flat, color='g')
    plt.plot(NewX[0].flat, NewX[1].flat, color='b')
    if(title):
        plt.title(title)
    plt.axis('equal')
    plt.show() 
    
plot_transformed_circle(X,    # First show the original circle
                        M*X)  # Then show the transformed circle

M = np.matrix([[2, 0],[0, 2]])
print('M'); print(M)
plot_transformed_circle(X,M*X)
M
[[2 0]
 [0 2]]

M = np.matrix([[1,2],[0, 1]])
print('M'); print(M)
plot_transformed_circle(X,M*X)
M
[[1 2]
 [0 1]]

np.random.seed(100); np.set_printoptions(precision=1)
# Now just create a random 2x2 matrix
R = np.matrix(np.random.rand(2,2))
print(R)

# Then transform points by that matrix
NX = R*X
plot_transformed_circle(X,NX)
[[0.5 0.3]
 [0.4 0.8]]

You can do this same thing to different dimensions of inputs, such as 1-D (lines):

X_line = np.linspace(-1,1,10)  # Just create a 1-D set of points
print("X_line:\n",X_line)
R[:,0]*X_line   # Convert it into 
print("Transformed:\n",R[:,0]*X_line)
plot_transformed_circle(np.vstack([X_line,np.zeros_like(X_line)]),
                        R[:,0]*X_line)
X_line:
 [-1.  -0.8 -0.6 ...  0.6  0.8  1. ]
Transformed:
 [[-0.5 -0.4 -0.3 ...  0.3  0.4  0.5]
 [-0.4 -0.3 -0.2 ...  0.2  0.3  0.4]]

C.1 The Singular Value Decomposition

For \(N\) data points of \(d\) dimensions: \[ X_{d\times N} = U_{d\times d} \Sigma_{d\times N} V^*_{N\times N} \] Where \(U\), \(V\) are orthogonal (\(UU^T=I\)), and \(\Sigma\) is diagonal.

NX
matrix([[ 0.5,  0.6,  0.6, ...,  0.3,  0.5,  0.5],
        [ 0.4,  0.6,  0.8, ..., -0.1,  0.2,  0.4]])
U,s,V = np.linalg.svd(NX,full_matrices=False) # Why is this useful?
S = np.diag(s)
print('U:', U.shape)
print('S:', S.shape) # Why is this only 2x2, rather than 2x25?
print('V:', V.shape) # Why is this only 2x25, rather than 25x25?
print('S ='); print(S)
print('U*U.T ='); print(U*U.T)
U: (2, 2)
S: (2, 2)
V: (2, 25)
S =
[[3.8 0. ]
 [0.  1.1]]
U*U.T =
[[1. 0.]
 [0. 1.]]
V
matrix([[-0.2, -0.2, -0.3, ..., -0. , -0.1, -0.2],
        [ 0.2,  0.2,  0.1, ...,  0.3,  0.3,  0.2]])
print('S ='); print(S)

# Allow me to plot multiple circles on one figure
def plot_ax(ax,X,title=None):
    ax.scatter(X[0].flat, X[1].flat,c='g')
    ax.set_xlim([-1.5, 1.5])
    ax.set_ylim([-1.5, 1.5])
    if(title):
        plt.title(title)   

fig = plt.figure()
plot_ax(fig.add_subplot(221, aspect='equal'),    NX, 'Original Data')
plot_ax(fig.add_subplot(223, aspect='equal'),     V, 'V')
plot_ax(fig.add_subplot(224, aspect='equal'),   S*V, 'S*V')
plot_ax(fig.add_subplot(222, aspect='equal'), U*S*V, 'U*S*V')
plt.show() # Essentially a "Change of Basis"
# U and V are orthogonal matrices, so they just represent Rotations/Reflections
S =
[[3.8 0. ]
 [0.  1.1]]

Y = circle_points(2,2/5) # Create points on a different ellipse
NY = R*Y  # Transform those points with a matrix
plot_transformed_circle(Y,NY)

# Do the SVD
U,s,V = np.linalg.svd(NY,full_matrices=False)
S = np.diag(s); print('S ='); print(S)

# Plot the data and the various SVD transformations
fig = plt.figure()
plot_ax(fig.add_subplot(221, aspect='equal'),    NY, 'Original Data')
plot_ax(fig.add_subplot(223, aspect='equal'),     V, 'V')
plot_ax(fig.add_subplot(224, aspect='equal'),   S*V, 'S*V')
plot_ax(fig.add_subplot(222, aspect='equal'), U*S*V, 'U*S*V')
plt.show()
S =
[[5.1 0. ]
 [0.  0.7]]

C.2 What about different dimensions?

M = np.matrix([[1,0,],[0,1],[2,0.5]])
r = np.matrix([[1],[1]])
print(f"M = {M}")
print(f"r = {r}")    # What are the dimensions of r?
print(f"M*r = {M*r}") # What are the dimensions of M*r?
M = [[1.  0. ]
 [0.  1. ]
 [2.  0.5]]
r = [[1]
 [1]]
M*r = [[1. ]
 [1. ]
 [2.5]]
# Let's plot the points in 3D 
def plot_3D_circle(X, elev=10., azim=50, title=None, c='b'):
    """
    Plots 3D points from a (3, N) matrix X using matplotlib.

    Parameters
    ----------
    X : np.ndarray or np.matrix
        3xN array of points to plot.
    elev : float, optional
        Elevation angle for the 3D plot.
    azim : float, optional
        Azimuth angle for the 3D plot.
    title : str, optional
        Title for the plot.
    c : str, optional
        Color for the points.
    """
    fig = plt.figure()
    ax = fig.add_subplot(111, projection='3d')
    x = np.array(X[0]).flatten()
    y = np.array(X[1]).flatten()
    z = np.array(X[2]).flatten()
    ax.scatter(x, y, z, c=c)
    # Create cubic bounding box to simulate equal aspect ratio
    max_range = np.array([x.max()-x.min(), y.max()-y.min(), z.max()-z.min()]).max()
    Xb = 0.5*max_range*np.mgrid[-1:2:2,-1:2:2,-1:2:2][0].flatten() + 0.5*(x.max()+x.min())
    Yb = 0.5*max_range*np.mgrid[-1:2:2,-1:2:2,-1:2:2][1].flatten() + 0.5*(y.max()+y.min())
    Zb = 0.5*max_range*np.mgrid[-1:2:2,-1:2:2,-1:2:2][2].flatten() + 0.5*(z.max()+z.min())
    for xb, yb, zb in zip(Xb, Yb, Zb):
        ax.plot([xb], [yb], [zb], 'w')
    ax.view_init(elev=elev, azim=azim)
    if title:
        plt.title(title)
    plt.show()
    
def plot_3D_ax(ax, X, elev=10., azim=50, title=None,c='b'):
    x = np.array(X[0].flat)
    y = np.array(X[1].flat)
    z = np.array(X[2].flat)
    ax.scatter(x,y,z,c=c)
    # Create cubic bounding box to simulate equal aspect ratio
    max_range = np.array([x.max()-x.min(), y.max()-y.min(), z.max()-z.min()]).max()
    Xb = 0.5*max_range*np.mgrid[-1:2:2,-1:2:2,-1:2:2][0].flatten() + 0.5*(x.max()+x.min())
    Yb = 0.5*max_range*np.mgrid[-1:2:2,-1:2:2,-1:2:2][1].flatten() + 0.5*(y.max()+y.min())
    Zb = 0.5*max_range*np.mgrid[-1:2:2,-1:2:2,-1:2:2][2].flatten() + 0.5*(z.max()+z.min())
    # Comment or uncomment following both lines to test the fake bounding box:
    for xb, yb, zb in zip(Xb, Yb, Zb):
       ax.plot([xb], [yb], [zb], 'w')
M = np.matrix([[1,0,],[0,1],[2,0.5]])
interactive_3D = lambda e,a: plot_3D_circle(M*X,elev=e,azim=a)
interact(interactive_3D, e=(0,90,30), a=(0,360,30))
<function __main__.<lambda>(e, a)>
M*X
matrix([[ 1. ,  1. ,  0.9, ...,  0.9,  1. ,  1. ],
        [ 0. ,  0.3,  0.5, ..., -0.5, -0.3, -0. ],
        [ 2. ,  2.1,  2. , ...,  1.5,  1.8,  2. ]])
M = np.matrix([[1,2],[-2,2],[2,0.5]])
print(M)
[[ 1.   2. ]
 [-2.   2. ]
 [ 2.   0.5]]
interactive_3D = lambda e,a: plot_3D_circle(M*Y,elev=e,azim=a)
interact(interactive_3D, e=(0,90,30), a = (0,360,30))
<function __main__.<lambda>(e, a)>
# M*Y is a 3D set of points
U,s,V = np.linalg.svd(M*Y,full_matrices=False)
S = np.diag(s)
print('U:', U.shape)
print('S:', S.shape)
print('V:', V.shape)
print('S =')
print(S)
U: (3, 3)
S: (3, 3)
V: (3, 25)
S =
[[21.6  0.   0. ]
 [ 0.   4.   0. ]
 [ 0.   0.   0. ]]
U*S
matrix([[ -7.1,   2.9,  -0. ],
        [ 14.5,   2.5,   0. ],
        [-14.4,   1. ,   0. ]])
V
matrix([[-0.3, -0.3, -0.2, ..., -0.2, -0.3, -0.3],
        [ 0. ,  0.1,  0.1, ..., -0.1, -0.1,  0. ],
        [-0.8,  0.5,  0.1, ..., -0. ,  0.1,  0. ]])
fig = plt.figure()
plt.plot(np.diag(S),'o-')
plt.title("Magnitude of Singular Values")
plt.show()

interactive_3D = lambda e,a: plot_3D_circle(V,elev=e,azim=a)
interact(interactive_3D, e=(0,90,30), a = (0,360,30))
<function __main__.<lambda>(e, a)>
interactive_3D = lambda e,a: plot_3D_circle(S*V,elev=e,azim=a)
interact(interactive_3D, e=(0,90,30), a = (0,360,30))
plt.show()
interactive_3D = lambda e,a: plot_3D_circle(U*S*V,elev=e,azim=a)
interact(interactive_3D, e=(0,90,30), a = (0,360,30))
<function __main__.<lambda>(e, a)>
print('S ='); print(S)
print('V ='); print(V)
print('S*V ='); print(S*V)
S =
[[21.6  0.   0. ]
 [ 0.   4.   0. ]
 [ 0.   0.   0. ]]
V =
[[-0.3 -0.3 -0.2 ... -0.2 -0.3 -0.3]
 [ 0.   0.1  0.1 ... -0.1 -0.1  0. ]
 [-0.8  0.5  0.1 ... -0.   0.1  0. ]]
S*V =
[[-6.  -5.8 -5.1 ... -5.3 -5.8 -6. ]
 [ 0.   0.3  0.6 ... -0.5 -0.3  0. ]
 [-0.   0.   0.  ... -0.   0.   0. ]]
# So if V's 3rd row doesn't matter, why don't we just get rid of it?
Vt = V[0:2,:]
St = S[:,0:2]
print('St ='); print(St)
print('Vt ='); print(Vt)
print('St*Vt ='); print(St*Vt)
St =
[[21.6  0. ]
 [ 0.   4. ]
 [ 0.   0. ]]
Vt =
[[-0.3 -0.3 -0.2 ... -0.2 -0.3 -0.3]
 [ 0.   0.1  0.1 ... -0.1 -0.1  0. ]]
St*Vt =
[[-6.  -5.8 -5.1 ... -5.3 -5.8 -6. ]
 [ 0.   0.3  0.6 ... -0.5 -0.3  0. ]
 [ 0.   0.   0.  ...  0.   0.   0. ]]
print('U ='); print(U)
U =
[[-0.3  0.7 -0.6]
 [ 0.7  0.6  0.4]
 [-0.7  0.3  0.7]]
# Truncate U. Now we have the "Truncated SVD"
Ut = U[:,0:2]
St = St[0:2,:]
print('Ut ='); print(Ut)
print('St ='); print(St)
print('Vt ='); print(Vt)
Ut =
[[-0.3  0.7]
 [ 0.7  0.6]
 [-0.7  0.3]]
St =
[[21.6  0. ]
 [ 0.   4. ]]
Vt =
[[-0.3 -0.3 -0.2 ... -0.2 -0.3 -0.3]
 [ 0.   0.1  0.1 ... -0.1 -0.1  0. ]]
print('Ut*St*Vt ='); print(Ut*St*Vt) # Even though we threw away info...
print('M*Y = '); print(M*Y)
print("Are they equal?: ", np.allclose(M*Y,Ut*St*Vt))
Ut*St*Vt =
[[ 2.   2.1  2.1 ...  1.3  1.7  2. ]
 [-4.  -3.7 -3.1 ... -3.9 -4.1 -4. ]
 [ 4.   3.9  3.6 ...  3.4  3.8  4. ]]
M*Y = 
[[ 2.   2.1  2.1 ...  1.3  1.7  2. ]
 [-4.  -3.7 -3.1 ... -3.9 -4.1 -4. ]
 [ 4.   3.9  3.6 ...  3.4  3.8  4. ]]
Are they equal?:  True
print(Vt)
plot_circle(Vt) # The actual basis which preserves data variability
[[-0.3 -0.3 -0.2 ... -0.2 -0.3 -0.3]
 [ 0.   0.1  0.1 ... -0.1 -0.1  0. ]]

# Let's make things more difficult - add some noise:
Z = M*X + np.random.normal(0,0.5,size=(M*X).shape)
interactive_3D = lambda e,a: plot_3D_circle(Z,elev=e,azim=a)
interact(interactive_3D, e=(0,90,30), a = (0,360,30))
<function __main__.<lambda>(e, a)>
Ue,se,Ve = np.linalg.svd(Z,full_matrices=False)
Se = np.diag(se)
print('S ='); print(Se) # What is different, compared to no-noise?
S =
[[11.5  0.   0. ]
 [ 0.   9.7  0. ]
 [ 0.   0.   2.8]]
# Truncate:
Uet = Ue[:,0:2]
Set = Se[0:2,0:2]
Vet = Ve[0:2,:]
print(Z); print(); print(Uet*Set*Vet)
[[ 1.5  1.7  2.  ...  0.2  1.1  0.8]
 [-2.  -1.3 -1.5 ... -3.  -2.9 -2.4]
 [ 2.1  2.3  1.6 ...  1.9  1.1  2.3]]

[[ 1.3  1.7  1.5 ...  0.2  0.5  0.9]
 [-1.9 -1.3 -1.2 ... -3.  -2.5 -2.5]
 [ 2.3  2.3  2.  ...  1.9  1.9  2.2]]
print("Are they equal?: ", np.allclose(Z,Uet*Set*Vet)) # We lost info
Are they equal?:  False
x = np.arange(-.2,.3,.05)
y = np.arange(-.6,.6,.1)
vep = np.matrix(np.transpose([np.tile(x, len(y)), np.repeat(y, len(x))]))
Zt = Uet*Set*vep.T
#Zt = Uet*Set*Vet
def compare_3D(Z, Zt, elev=10., azim=50):
    """
    Plots two sets of 3D points for visual comparison.

    Parameters
    ----------
    Z : np.ndarray or np.matrix
        Original 3D data (shape: 3 x N).
    Zt : np.ndarray or np.matrix
        Transformed 3D data (shape: 3 x N).
    elev : float, optional
        Elevation angle for the 3D plot.
    azim : float, optional
        Azimuth angle for the 3D plot.
    """
    fig = plt.figure()
    ax = fig.add_subplot(111, projection='3d')
    # Ensure shapes are (3, N)
    Z = np.asarray(Z)
    Zt = np.asarray(Zt)
    # If Zt is 2D, pad with zeros for 3D visualization
    if Zt.shape[0] == 2:
        Zt = np.vstack([Zt, np.zeros(Zt.shape[1])])
    ax.scatter(Z[0], Z[1], Z[2], c='b', label='Original')
    ax.scatter(Zt[0], Zt[1], Zt[2], c='g', label='Transformed')
    ax.view_init(elev=elev, azim=azim)
    ax.set_xlabel('X')
    ax.set_ylabel('Y')
    ax.set_zlabel('Z')
    ax.legend()
    plt.tight_layout()
    plt.show()
interactive_3D = lambda e,a: compare_3D(Z,Zt,elev=e,azim=a)
interact(interactive_3D, e=(0,90,30), a = (0,360,30))
<function __main__.<lambda>(e, a)>

The idea of uncovering structure, or reducing data-dimensions is one key goal of Unsupervised Learning. In particular, the SVD (among other methods) can be used for Principal Component Analysis: reducing the number of dimensions of a data-set, by finding a linear transformation to a smaller orthogonal basis which minimizes reconstruction error to the original space.

from sklearn.decomposition import PCA
pcaY = PCA(n_components=2).fit_transform(np.asarray(Z).T)
pcaY = np.array([[-.1,0],[0,-.1]])@pcaY.T # Some scaling/flipping
fig = plt.figure()
plot_ax(fig.add_subplot(121, aspect='equal'), 4*pcaY, 'PCA')
plot_ax(fig.add_subplot(122, aspect='equal'),  4*Vet, 'SVD')
plt.show()
# Note: result is (essentially) identical to PCA (up to scale/flipped axes)